N,N,2-Trimethylbenzenamine Dèanadair/Càileachd àrd/Prìs as fheàrr/Ann an stoc CAS NO.609-72-3
Iarrtas
prìomh phort Sìona
| Ainm toraidh | N, N-Dimethyl-o-toluidine |
| Co-fhaclan | 2-(Dimethylamino)toluene |
| Foirmle Molecular | C9H13N |
| Cuideam Molecular | 135.21 |
| InChI | InChI=1/C9H13N/c1-8-6-4-5-7-9(8)10(2)3/h4-7H,1-3H3 |
| Àireamh Clàraidh CAS | 609-72-3 |
| EINECS | 210-199-8 |
| Structar Molecular |
|
| Dùmhlachd | 0.929 |
| Goil puing | 76 ℃ (18 mmHg) |
| Clàr-innse ath-bheòthail | 1.524-1.526 |
| Flash puing | 63 ℃ |
| Samhlaidhean Cunnart | T: puinnseanta; |
| Còdan Cunnairt | R23/24/25:; R33:; R52/53:; |
| Tuairisgeul sàbhailteachd | S28A:; S36/37:; S45:; S61:; |
Mion-fhiosrachadh sgiobalta
| Nì | Inbhe | Toraidhean deuchainn | |
| Aithneachadh | AH-NMR: Cum ris an structar | Gèilleadh | |
| B.LC-MS: Cumail ris an structar | Gèilleadh | ||
| C. Bu chòir an speactram sampall IR a bhith co-ionann ris an ìre iomraidh; | Gèilleadh | ||
| D.HPLC-ESI-MS Tha an ùine gleidhidh aig a’ phrìomh stùc ann an cromatogram an ullachaidh Assay a’ freagairt ris an ùine ann an cromatogram an ullachaidh àbhaisteach, mar a gheibhear san Assay. | Gèilleadh | ||
| Call air tiormachadh | ≤0.5% | 0.11% | |
| Meatailtean trom | ≤10 ppm | <10 ppm | |
| luaithre sulfated | ≤0.2%, air a dhearbhadh air 1.0 g. | 0.009% | |
| Stuthan co-cheangailte | Neo-chunbhalachd neo-ainmichte: airson gach neo-dhìomhaireachd | ≤0.10% | <0.10% |
| Impurity iomlan | ≤1.0% | 0.18% | |
| Purity | ≥99.0% | 99.82% | |
| Assay | 99.0% ~ 101.0% (stuth anhydrous). | 99.9% | |
Tha Mit-Ivy na neach-dèanamh cheimigean grinn agus eadar-mheadhanan cungaidh-leigheis le taic làidir R&D ann an Sìona.
Sa mhòr-chuid an sàs, Indole, Thiophene, Pyrimidine, Aniline, stuthan clorine.
Paimhleas:gabhail ris a h-uile pàigheadh
0086 1996 1957599info@mit-ivy.com
| N,N-Diethyl-m-toluidine | 91-67-8 |
| N, N-Diethyl aniline | 91-66-7 |
| N, N-Dicyanoethylaniline | 1555-66-4 |
| N, N-dihydroxyethyl-m-toluidine | 28005-74-5 |
| N,N-DIHYDROXYETHYL-P-TOLUIDINE DHEPT | .3077-12-1 |
| N, N-Dihydroxyethylaniline PDEA | 120-07-0 |
| N, N-Dimethylacetamide DMAC | 127-19-5 |
| N, N-Dimethyl-o-toluidine DMOT | 609-72-3 |
| N,N-DIMETHYL-M-TOLUIDINE | 121-72-2 |
| N, N-Dimethylcyclohexylamine | 98-94-2 |
| N, N-Dimethyl-p-toluidine DMPT | 99-97-8 |
| N, N-Dimethylaniline DMA | 121-69-7 |
| N, N-Dimethyl-1,4-phenylenediamine DMPD | 99-98-9 |
| N, N-Dibenzylhydroxylamine | 621-07-8 |
| N-(4-aminobenzoyl)-L-glutamic acid | 4271-30-1 |
| N-ISOPROPYLANILINE | 768-52-5 |
| N-Ethyl-o-toluidine | 94-68-8 |
| N-Ethylaniline | 103-69-5 |
| N-Ethyl-m-toluidine | 102-27-2 |
| 3-(N-ethylanilino) propiononitrile | 148-87-8 |
| N-Ethyl-N-hydroxyethylaniline | 92-50-2 |
| N-Benzyl-N-ethyl-m-toluidine | 119-94-8 |
| N-ethyl-N-phenylbenzenemethanamine | 92-59-1 |
| N-Methylformanilide | 93-61-8 |
| NMP, N-Methyl-2-pyrrolidone | 872-50-4 |
| N-α-Methyl-DL-alanine | 600-21-5 |
| N, N-Diethylacetamide | 685-91-6 |
| N, N-diethylcarbamyl chloride | 88-10-8 |
| L-Norvaline | 6600-40-4 |
| L-tert.leucine | 20859-02-3 |
| L-Leucine benzyl ester p-toluenesulfonate salann | 1738-77-8 |
| L-Alanine isopropyl ester hydrochloride | 62062-65-1 |
| L-Phenyl glycine / (S) -(+)-2-Phenylglycine | 2935-35-5 |
| Fmoc-Ala-OH | 35661-39-3 |
| D-Norleucine | 327-56-0 |
| D-Sreine | 312-84-5 |
| D-Tiorosine | 556-02-5 |
| BOC-L-GLUTAMIC ACID DIMETHYL ESTER | 59279-60-6 |
| BOC-D-Serine | 6368-20-3 |
| 6-Chloro-2,4-dinitroaniline | 3531-19-9 |
| 5-Fluoro-2-oxindole | 56341-41-4 |
| 5-Fluorocytosine | 2022-87-5 |
| L-4-Nitrophenylalanine methyl ester hydrochloride | 17193-40-7 |
| 4 - cyanopyridine | 100-48-1 |
| 4,6-Dihydroxypyrimidine | 1193-24-4 |
| 4,6-dichloro pyrimidine | 1193-21-1 |
| 3 - cyanopyridine | 100-54-9 |
| 3-Methyl-pyridine | 108-99-6 |
| 2,2'-[(3-Acetamidophenyl) imino] diacetate diethyl | 27059-08-1 |
| Bromamine acid | 5537-71-3 |
| 2-Acetylthiophene | 88-15-3 |
| 2-Bromo-5-fluorobenzotrifluoride | 40161-55-5 |
| 2-Thiopheneacetyl chloride | 39098-97-0 |
| 2-Thienylacetic acid | 1918-77-0 |
| 2 - Naphthol Naphthol beta | 135-19-3 |
| 2-Amino-5-bromopyridine | 87-63-8 |
| 2-Chloro-6-fluorotoluene | 443-83-4 |
| 2-Thiouracil | 141-90-2 |
| 2-Amino-6-CHLOROPURINE | 10310-21-1 |
| 2,6-Dichloropurine | 5451-40-1 |
| 2,6-Dichlorobenzyl chloride | 2014-83-7 |
| 2,6-Difluorobenzamide | 18063-03-1 |
| 2,6-Difluorotoluene | 5509-65-9 |
| 2,5-Dibromopyridine | 624-28-2 |
| 2,4-Dichloronitrobenzene | 611-06-3 |
| 2,4-Dichlorobenzotrifluoride | 320-60-5 |
| 2,4-Dichlorobenzyl chloride | 94-99-5 |
| 2, 4-dichlorotoluene | 95-73-8 |
| 2,4 Dichloro aniline | 554-00-7 |
| 4-Chloro-2,6-diaminopyrimidine | 156-83-2 |
| 2: 4 Dichloro Benzaldehyde | 874-42-0 |
| 1H-Pyrazole-1-carboxamidine hydrochloride | 4023-02-3. |
| Hexadecylpyridinium chloride | 6004-24-6 |
| 1,4-Dihydroxyanthraquinone (Quinizarin) | 81-64-1 |
| 1,2,4-Triazole | 288-88-0 |
| (S) -3-Hidroxytetrahydrofuran | 86087-23-2 |
| (R) -3-Boc-aminopiperidine | 309956-78-3 |
| Triethylenetetramine | 112-24-3 |
| 2,6-Dichlorophenol | 87-65-0 |
| Dodecyl pyridine chloride | 104-74-5 |
| (-)-Di-p-toluoyl-L-tartaric acid | 32634-66-5 |
| Methyl 4-(butyrylamino)-3-methyl-5-nitrobenzoate | 152628-01-8 |
| Isophorone diamine IPDA | 2855-13-2 |
| MONOCHLOROACETONE | 78-95-5 |
| Ethyl-4-choloro-3-oxobutanoate | 638-07-3 |
| fosphoryl trichloride | 10025-87-3 |
| 1,1,3-Trichloroacetone | 921-03-9 |
| 2-BUTYL-4-CHLORO-5-FORMYL IMIDAZOLE | 83857-96-9 |
| 2-Chlorobenzyl chloride | 611-19-8 |
| 2-Chlorobenzonitrile | 873-32-5 |
| 2-Chlorobenzaldehyde | 89-98-5 |
| 2-Methylbenzyl chloride MBC | 552-45-4 |
| 2-Methylbenzyl cyanide | 22364-68-7 |
| 3-Hydroxymethyl-2-methylbiphenyl | 76350-90-8 |
| 6,6-Dimethyl-3-oxabicyclo [3.1.0] hexane-2,4-dione | 67911-21-1 |
| POLY (ETHYLENE GLYCOL) Dimethacrylate | 25852-47-5 |
| POLY (HEXAMETHYLENE DISOCYANATE HDI | 28182-81-2 |
| Crystal violet lactone CVL | 1552-42-7 |
| m-Toluidín MT | 108-44-1 |
| 1,3-Bis (trifluoromethyl) benzene | 402-31-3 |
| m-Phenylenediamine MPDA | 108-45-2 |
| 4-Chlorobenzotrifluoride p-Chlorobenzotrifluoride | 98-56-6 |
| Dodecyltrimethoxysilane n-Dodecyltrimethoxysilane | 3069-21-4 |
| 4-Methylbenzyl chloride | 104-82-5 |
| 4-Dimethylaminobenzaldehyde | 100-10-7 |
| PARA AMINO PHENOL | 123-30-8 |
| Pyridine | 110-86-1 |
| Cytosin | 71-30-7 |
| S-(-)-a-phenylethylamine | 2627-86-3 |
| R-α-methylbenzylamine | 3886-69-9 |
MIT -IVY Chemicals Industry Co., Ltd.na phrìomh neach-dèanamh airson 19bliadhnaichean anns a bheil 4 factaraidhean,às-mhalairt de *stuth-dathEadar-mheadhanach& cungaidhean-leighis eadar-mheadhanach &ceimigean grinn & sònraichte*.*https://www.mit-ivy.com*
Athena ceannard
Whatsapp / wechat: +86 13805212761
Companaidh gnìomhachas Mit-ivy
ADD:Roinn Jiangsu, Sìona












